C25H34N2O4 — CID 58373346
2-[(E)-[(6E,10E)-16,18-dimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxy-N,N-diethylacetamide (PubChem CID 58373346) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-[(E)-[(6E,10E)-16,18-dimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxy-N,N-diethylacetamide.
| Compound Name | 2-[(E)-[(6E,10E)-16,18-dimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxy-N,N-diethylacetamide |
|---|---|
| PubChem CID | 58373346 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-[(E)-[(6E,10E)-16,18-dimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxy-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CO/N=C1/C=C/CC/C=C/CCOC(=O)c2c(C)cc(C)cc2C1 |
| InChI | InChI=1S/C25H34N2O4/c1-5-27(6-2)23(28)18-31-26-22-13-11-9-7-8-10-12-14-30-25(29)24-20(4)15-19(3)16-21(24)17-22/h8,10-11,13,15-16H,5-7,9,12,14,17-18H2,1-4H3/b10-8+,13-11+,26-22- |
| InChIKey | ZYJCGUFHRNLIGJ-HWIMNPQUSA-N |
| XLogP | 4.54 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|