C22H28N2O4 — CID 123630798
2-[(E)-[(6E)-16,18-dimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxy-N-methylacetamide (PubChem CID 123630798) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[(E)-[(6E)-16,18-dimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxy-N-methylacetamide.
| Compound Name | 2-[(E)-[(6E)-16,18-dimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxy-N-methylacetamide |
|---|---|
| PubChem CID | 123630798 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[(E)-[(6E)-16,18-dimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxy-N-methylacetamide |
| SMILES | CNC(=O)CO/N=C1/C=CCC/C=C/CCOC(=O)c2c(C)cc(C)cc2C1 |
| InChI | InChI=1S/C22H28N2O4/c1-16-12-17(2)21-18(13-16)14-19(24-28-15-20(25)23-3)10-8-6-4-5-7-9-11-27-22(21)26/h5,7-8,10,12-13H,4,6,9,11,14-15H2,1-3H3,(H,23,25)/b7-5+,10-8?,24-19- |
| InChIKey | HIDCQXOJSWAQKG-CGICLCHXSA-N |
| XLogP | 3.42 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|