C28H38N2O4 — CID 58373274
(6E,10E,12E)-12-[2-(2-ethylpiperidin-1-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one (PubChem CID 58373274) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is (6E,10E,12E)-12-[2-(2-ethylpiperidin-1-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one.
| Compound Name | (6E,10E,12E)-12-[2-(2-ethylpiperidin-1-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 58373274 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (6E,10E,12E)-12-[2-(2-ethylpiperidin-1-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
| SMILES | CCC1CCCCN1C(=O)CO/N=C1/C=C/CC/C=C/CCOC(=O)c2c(C)cc(C)cc2C1 |
| InChI | InChI=1S/C28H38N2O4/c1-4-25-14-10-11-15-30(25)26(31)20-34-29-24-13-9-7-5-6-8-12-16-33-28(32)27-22(3)17-21(2)18-23(27)19-24/h6,8-9,13,17-18,25H,4-5,7,10-12,14-16,19-20H2,1-3H3/b8-6+,13-9+,29-24- |
| InChIKey | BYUNFVRBGVLZBK-MWECHTBMSA-N |
| XLogP | 5.46 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|