C26H36N2O4 — CID 123667446
N,N-diethyl-2-[(E)-[(4R,6E)-4,16,18-trimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxyacetamide (PubChem CID 123667446) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is N,N-diethyl-2-[(E)-[(4R,6E)-4,16,18-trimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxyacetamide.
| Compound Name | N,N-diethyl-2-[(E)-[(4R,6E)-4,16,18-trimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 123667446 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | N,N-diethyl-2-[(E)-[(4R,6E)-4,16,18-trimethyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxyacetamide |
| SMILES | CCN(CC)C(=O)CO/N=C1/C=CCC/C=C/C[C@@H](C)OC(=O)c2c(C)cc(C)cc2C1 |
| InChI | InChI=1S/C26H36N2O4/c1-6-28(7-2)24(29)18-31-27-23-14-12-10-8-9-11-13-21(5)32-26(30)25-20(4)15-19(3)16-22(25)17-23/h9,11-12,14-16,21H,6-8,10,13,17-18H2,1-5H3/b11-9+,14-12?,27-23-/t21-/m1/s1 |
| InChIKey | UPJBQPHWOLCDMI-SITSMJMPSA-N |
| XLogP | 4.93 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|