C32H33NO3 — CID 59578186
(4S,6E,10E,12Z)-16,18-dimethyl-4-phenyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one (PubChem CID 59578186) has the molecular formula C32H33NO3 and a molecular weight of 479.62 g/mol. Its IUPAC name is (4S,6E,10E,12Z)-16,18-dimethyl-4-phenyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one.
| Compound Name | (4S,6E,10E,12Z)-16,18-dimethyl-4-phenyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 59578186 |
| Molecular Formula | C32H33NO3 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (4S,6E,10E,12Z)-16,18-dimethyl-4-phenyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
| SMILES | Cc1cc(C)c2c(c1)CC(=N/OCc1ccccc1)/C=C/CC/C=C/C[C@@H](c1ccccc1)OC2=O |
| InChI | InChI=1S/C32H33NO3/c1-24-20-25(2)31-28(21-24)22-29(33-35-23-26-14-8-6-9-15-26)18-12-4-3-5-13-19-30(36-32(31)34)27-16-10-7-11-17-27/h5-18,20-21,30H,3-4,19,22-23H2,1-2H3/b13-5+,18-12+,33-29+/t30-/m0/s1 |
| InChIKey | FGNYLHNIYSULJS-MFRLXFCYSA-N |
| XLogP | 7.61 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|