C26H28ClNO5 — CID 59578173
(4R,5S,6E,10E,12Z)-15-chloro-16,18-dihydroxy-4,5-dimethyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 59578173) has the molecular formula C26H28ClNO5 and a molecular weight of 469.97 g/mol. Its IUPAC name is (4R,5S,6E,10E,12Z)-15-chloro-16,18-dihydroxy-4,5-dimethyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (4R,5S,6E,10E,12Z)-15-chloro-16,18-dihydroxy-4,5-dimethyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 59578173 |
| Molecular Formula | C26H28ClNO5 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (4R,5S,6E,10E,12Z)-15-chloro-16,18-dihydroxy-4,5-dimethyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | C[C@H]1/C=C/CC/C=C/C(=N\OCc2ccccc2)Cc2c(Cl)c(O)cc(O)c2C(=O)O[C@@H]1C |
| InChI | InChI=1S/C26H28ClNO5/c1-17-10-6-3-4-9-13-20(28-32-16-19-11-7-5-8-12-19)14-21-24(26(31)33-18(17)2)22(29)15-23(30)25(21)27/h5-13,15,17-18,29-30H,3-4,14,16H2,1-2H3/b10-6+,13-9+,28-20+/t17-,18+/m0/s1 |
| InChIKey | ROLHJIZLIIVOGW-OVRFQYJESA-N |
| XLogP | 5.95 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|