C20H23ClN2O6 — CID 172942898
(6E,10E,12E)-15-chloro-12-ethoxyimino-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one;isocyanic acid (PubChem CID 172942898) has the molecular formula C20H23ClN2O6 and a molecular weight of 422.87 g/mol. Its IUPAC name is (6E,10E,12E)-15-chloro-12-ethoxyimino-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one;isocyanic acid.
| Compound Name | (6E,10E,12E)-15-chloro-12-ethoxyimino-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one;isocyanic acid |
|---|---|
| PubChem CID | 172942898 |
| Molecular Formula | C20H23ClN2O6 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (6E,10E,12E)-15-chloro-12-ethoxyimino-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one;isocyanic acid |
| SMILES | CCO/N=C1/C=C/CC/C=C/CCOC(=O)c2c(O)cc(O)c(Cl)c2C1.N=C=O |
| InChI | InChI=1S/C19H22ClNO5.CHNO/c1-2-26-21-13-9-7-5-3-4-6-8-10-25-19(24)17-14(11-13)18(20)16(23)12-15(17)22;2-1-3/h4,6-7,9,12,22-23H,2-3,5,8,10-11H2,1H3;2H/b6-4+,9-7+,21-13-; |
| InChIKey | CNHGSUYMIZNPJM-IPNMCMIUSA-N |
| XLogP | 4.04 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|