C24H31ClN2O6 — CID 138492068
(6E,10E,12Z)-15-chloro-16,18-dihydroxy-12-(2-hydroxy-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 138492068) has the molecular formula C24H31ClN2O6 and a molecular weight of 478.97 g/mol. Its IUPAC name is (6E,10E,12Z)-15-chloro-16,18-dihydroxy-12-(2-hydroxy-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12Z)-15-chloro-16,18-dihydroxy-12-(2-hydroxy-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 138492068 |
| Molecular Formula | C24H31ClN2O6 |
| Molecular Weight | 478.97 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (6E,10E,12Z)-15-chloro-16,18-dihydroxy-12-(2-hydroxy-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | O=C1OCC/C=C/CC/C=C/C(=N\OCC(O)N2CCCCC2)Cc2c(Cl)c(O)cc(O)c21 |
| InChI | InChI=1S/C24H31ClN2O6/c25-23-18-14-17(26-33-16-21(30)27-11-7-5-8-12-27)10-6-3-1-2-4-9-13-32-24(31)22(18)19(28)15-20(23)29/h2,4,6,10,15,21,28-30H,1,3,5,7-9,11-14,16H2/b4-2+,10-6+,26-17+ |
| InChIKey | IFEVRCNUJWVPRL-IKYPLCSFSA-N |
| XLogP | 3.92 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.97 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|