C23H23ClO5 — CID 143627522
benzene;(6E,10E)-15-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione (PubChem CID 143627522) has the molecular formula C23H23ClO5 and a molecular weight of 414.88 g/mol. Its IUPAC name is benzene;(6E,10E)-15-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione.
| Compound Name | benzene;(6E,10E)-15-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
|---|---|
| PubChem CID | 143627522 |
| Molecular Formula | C23H23ClO5 |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | benzene;(6E,10E)-15-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
| SMILES | O=C1/C=C/CC/C=C/CCOC(=O)c2c(O)cc(O)c(Cl)c2C1.c1ccccc1 |
| InChI | InChI=1S/C17H17ClO5.C6H6/c18-16-12-9-11(19)7-5-3-1-2-4-6-8-23-17(22)15(12)13(20)10-14(16)21;1-2-4-6-5-3-1/h2,4-5,7,10,20-21H,1,3,6,8-9H2;1-6H/b4-2+,7-5+; |
| InChIKey | OHWCTFNOMAZHDJ-ZUEAPKHESA-N |
| XLogP | 5.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|