C17H18O4 — CID 143627405
(6E,10E)-18-hydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione (PubChem CID 143627405) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (6E,10E)-18-hydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione.
| Compound Name | (6E,10E)-18-hydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
|---|---|
| PubChem CID | 143627405 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (6E,10E)-18-hydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
| SMILES | O=C1/C=C/CC/C=C/CCOC(=O)c2c(O)cccc2C1 |
| InChI | InChI=1S/C17H18O4/c18-14-9-5-3-1-2-4-6-11-21-17(20)16-13(12-14)8-7-10-15(16)19/h2,4-5,7-10,19H,1,3,6,11-12H2/b4-2+,9-5+ |
| InChIKey | XFWFDAUGEWZNIP-UDBWGUGXSA-N |
| XLogP | 2.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|