C22H26O6 — CID 143627391
(6E,10E)-16,18-dihydroxy-15-(oxan-2-yl)-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaene-2,12-dione (PubChem CID 143627391) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is (6E,10E)-16,18-dihydroxy-15-(oxan-2-yl)-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaene-2,12-dione.
| Compound Name | (6E,10E)-16,18-dihydroxy-15-(oxan-2-yl)-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaene-2,12-dione |
|---|---|
| PubChem CID | 143627391 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (6E,10E)-16,18-dihydroxy-15-(oxan-2-yl)-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaene-2,12-dione |
| SMILES | O=C1/C=C/CC/C=C/CCOC(=O)c2c(O)cc(O)c(C3CCCCO3)c2C1 |
| InChI | InChI=1S/C22H26O6/c23-15-9-5-3-1-2-4-7-12-28-22(26)21-16(13-15)20(17(24)14-18(21)25)19-10-6-8-11-27-19/h2,4-5,9,14,19,24-25H,1,3,6-8,10-13H2/b4-2+,9-5+ |
| InChIKey | QKBWEUBRSHSVKH-UDBWGUGXSA-N |
| XLogP | 3.90 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|