C24H30O6 — CID 131970823
(4S,6E,10E)-4-ethenyl-12,16,18-trihydroxy-15-(oxan-2-yl)-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one (PubChem CID 131970823) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (4S,6E,10E)-4-ethenyl-12,16,18-trihydroxy-15-(oxan-2-yl)-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one.
| Compound Name | (4S,6E,10E)-4-ethenyl-12,16,18-trihydroxy-15-(oxan-2-yl)-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 131970823 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (4S,6E,10E)-4-ethenyl-12,16,18-trihydroxy-15-(oxan-2-yl)-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
| SMILES | C=C[C@@H]1C/C=C/CC/C=C/C(O)Cc2c(c(O)cc(O)c2C2CCCCO2)C(=O)O1 |
| InChI | InChI=1S/C24H30O6/c1-2-17-11-7-5-3-4-6-10-16(25)14-18-22(21-12-8-9-13-29-21)19(26)15-20(27)23(18)24(28)30-17/h2,5-7,10,15-17,21,25-27H,1,3-4,8-9,11-14H2/b7-5+,10-6+/t16?,17-,21?/m1/s1 |
| InChIKey | WSJLPRPSFLFURQ-DQMLCQINSA-N |
| XLogP | 4.25 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|