C22H29ClO6 — CID 91383880
(4R,6S,8S,13R)-17-butoxy-16-chloro-13,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraen-2-one (PubChem CID 91383880) has the molecular formula C22H29ClO6 and a molecular weight of 424.92 g/mol. Its IUPAC name is (4R,6S,8S,13R)-17-butoxy-16-chloro-13,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraen-2-one.
| Compound Name | (4R,6S,8S,13R)-17-butoxy-16-chloro-13,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraen-2-one |
|---|---|
| PubChem CID | 91383880 |
| Molecular Formula | C22H29ClO6 |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (4R,6S,8S,13R)-17-butoxy-16-chloro-13,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraen-2-one |
| SMILES | CCCCOc1cc(O)c2c(c1Cl)C[C@@H](O)C=CCC[C@@H]1O[C@H]1C[C@@H](C)OC2=O |
| InChI | InChI=1S/C22H29ClO6/c1-3-4-9-27-19-12-16(25)20-15(21(19)23)11-14(24)7-5-6-8-17-18(29-17)10-13(2)28-22(20)26/h5,7,12-14,17-18,24-25H,3-4,6,8-11H2,1-2H3/t13-,14+,17+,18+/m1/s1 |
| InChIKey | IULOJPRXFDMPIU-BODMPHMZSA-N |
| XLogP | 4.18 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|