C18H19ClO7 — CID 162974743
(4R,6S,8R,10R)-16-chloro-10,13,17,19-tetrahydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,13,16,18-pentaen-2-one (PubChem CID 162974743) has the molecular formula C18H19ClO7 and a molecular weight of 382.80 g/mol. Its IUPAC name is (4R,6S,8R,10R)-16-chloro-10,13,17,19-tetrahydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,13,16,18-pentaen-2-one.
| Compound Name | (4R,6S,8R,10R)-16-chloro-10,13,17,19-tetrahydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,13,16,18-pentaen-2-one |
|---|---|
| PubChem CID | 162974743 |
| Molecular Formula | C18H19ClO7 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (4R,6S,8R,10R)-16-chloro-10,13,17,19-tetrahydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,13,16,18-pentaen-2-one |
| SMILES | C[C@@H]1C[C@@H]2O[C@@H]2C[C@@H](O)C=CC(O)=Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H19ClO7/c1-8-4-14-15(26-14)6-10(21)3-2-9(20)5-11-16(18(24)25-8)12(22)7-13(23)17(11)19/h2-3,5,7-8,10,14-15,20-23H,4,6H2,1H3/t8-,10+,14+,15-/m1/s1 |
| InChIKey | NZMLRMZZFPSQHJ-RMQCSFIASA-N |
| XLogP | 2.67 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|