C18H18Cl2O6 — CID 91195887
(4R,6S,7S)-7,15-dichloro-6,16,18-trihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),8,10,15,17-pentaene-2,12-dione (PubChem CID 91195887) has the molecular formula C18H18Cl2O6 and a molecular weight of 401.24 g/mol. Its IUPAC name is (4R,6S,7S)-7,15-dichloro-6,16,18-trihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),8,10,15,17-pentaene-2,12-dione.
| Compound Name | (4R,6S,7S)-7,15-dichloro-6,16,18-trihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),8,10,15,17-pentaene-2,12-dione |
|---|---|
| PubChem CID | 91195887 |
| Molecular Formula | C18H18Cl2O6 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | (4R,6S,7S)-7,15-dichloro-6,16,18-trihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),8,10,15,17-pentaene-2,12-dione |
| SMILES | C[C@@H]1C[C@H](O)[C@@H](Cl)C=CC=CC(=O)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H18Cl2O6/c1-9-6-13(22)12(19)5-3-2-4-10(21)7-11-16(18(25)26-9)14(23)8-15(24)17(11)20/h2-5,8-9,12-13,22-24H,6-7H2,1H3/t9-,12+,13+/m1/s1 |
| InChIKey | MQEXBOUTQRMRFJ-ICCXJUOJSA-N |
| XLogP | 2.89 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|