C18H19ClO6 — CID 143627499
(3S,14E,17S)-10-chloro-7,9-dihydroxy-3-methyl-4,18-dioxatricyclo[15.1.1.06,11]nonadeca-6(11),7,9,14-tetraene-5,13-dione (PubChem CID 143627499) has the molecular formula C18H19ClO6 and a molecular weight of 366.80 g/mol. Its IUPAC name is (3S,14E,17S)-10-chloro-7,9-dihydroxy-3-methyl-4,18-dioxatricyclo[15.1.1.06,11]nonadeca-6(11),7,9,14-tetraene-5,13-dione.
| Compound Name | (3S,14E,17S)-10-chloro-7,9-dihydroxy-3-methyl-4,18-dioxatricyclo[15.1.1.06,11]nonadeca-6(11),7,9,14-tetraene-5,13-dione |
|---|---|
| PubChem CID | 143627499 |
| Molecular Formula | C18H19ClO6 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (3S,14E,17S)-10-chloro-7,9-dihydroxy-3-methyl-4,18-dioxatricyclo[15.1.1.06,11]nonadeca-6(11),7,9,14-tetraene-5,13-dione |
| SMILES | C[C@H]1CC2C[C@H](C/C=C/C(=O)Cc3c(Cl)c(O)cc(O)c3C(=O)O1)O2 |
| InChI | InChI=1S/C18H19ClO6/c1-9-5-12-7-11(25-12)4-2-3-10(20)6-13-16(18(23)24-9)14(21)8-15(22)17(13)19/h2-3,8-9,11-12,21-22H,4-7H2,1H3/b3-2+/t9-,11-,12?/m0/s1 |
| InChIKey | UKBSVAHACOAXJC-AZOQLXBVSA-N |
| XLogP | 2.92 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |