C23H23ClO6 — CID 131970706
(10E)-15-chloro-16,18-dihydroxy-6-methyl-4-phenyl-3,7-dioxabicyclo[12.4.0]octadeca-1(14),10,15,17-tetraene-2,12-dione (PubChem CID 131970706) has the molecular formula C23H23ClO6 and a molecular weight of 430.88 g/mol. Its IUPAC name is (10E)-15-chloro-16,18-dihydroxy-6-methyl-4-phenyl-3,7-dioxabicyclo[12.4.0]octadeca-1(14),10,15,17-tetraene-2,12-dione.
| Compound Name | (10E)-15-chloro-16,18-dihydroxy-6-methyl-4-phenyl-3,7-dioxabicyclo[12.4.0]octadeca-1(14),10,15,17-tetraene-2,12-dione |
|---|---|
| PubChem CID | 131970706 |
| Molecular Formula | C23H23ClO6 |
| Molecular Weight | 430.88 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (10E)-15-chloro-16,18-dihydroxy-6-methyl-4-phenyl-3,7-dioxabicyclo[12.4.0]octadeca-1(14),10,15,17-tetraene-2,12-dione |
| SMILES | CC1CC(c2ccccc2)OC(=O)c2c(O)cc(O)c(Cl)c2CC(=O)/C=C/CCO1 |
| InChI | InChI=1S/C23H23ClO6/c1-14-11-20(15-7-3-2-4-8-15)30-23(28)21-17(22(24)19(27)13-18(21)26)12-16(25)9-5-6-10-29-14/h2-5,7-9,13-14,20,26-27H,6,10-12H2,1H3/b9-5+ |
| InChIKey | LNZGROFAUYRQAR-WEVVVXLNSA-N |
| XLogP | 4.52 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |