C20H28O5 — CID 131970790
(4S,6E,12R)-12,16,18-trihydroxy-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one (PubChem CID 131970790) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (4S,6E,12R)-12,16,18-trihydroxy-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one.
| Compound Name | (4S,6E,12R)-12,16,18-trihydroxy-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one |
|---|---|
| PubChem CID | 131970790 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (4S,6E,12R)-12,16,18-trihydroxy-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one |
| SMILES | CC(C)[C@@H]1C/C=C/CCCC[C@@H](O)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C20H28O5/c1-13(2)18-9-7-5-3-4-6-8-15(21)10-14-11-16(22)12-17(23)19(14)20(24)25-18/h5,7,11-13,15,18,21-23H,3-4,6,8-10H2,1-2H3/b7-5+/t15-,18+/m1/s1 |
| InChIKey | GIJFJTLKMADQRD-USVNEQSZSA-N |
| XLogP | 3.70 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|