C19H23ClO5 — CID 131970651
(4R,6E)-10-chloro-16,18-dihydroxy-4-methyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-12-carbaldehyde (PubChem CID 131970651) has the molecular formula C19H23ClO5 and a molecular weight of 366.84 g/mol. Its IUPAC name is (4R,6E)-10-chloro-16,18-dihydroxy-4-methyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-12-carbaldehyde.
| Compound Name | (4R,6E)-10-chloro-16,18-dihydroxy-4-methyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-12-carbaldehyde |
|---|---|
| PubChem CID | 131970651 |
| Molecular Formula | C19H23ClO5 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (4R,6E)-10-chloro-16,18-dihydroxy-4-methyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-12-carbaldehyde |
| SMILES | C[C@@H]1C/C=C/CCC(Cl)CC(C=O)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C19H23ClO5/c1-12-5-3-2-4-6-15(20)8-13(11-21)7-14-9-16(22)10-17(23)18(14)19(24)25-12/h2-3,9-13,15,22-23H,4-8H2,1H3/b3-2+/t12-,13?,15?/m1/s1 |
| InChIKey | JIZXNHBUDTXAMI-QBAITFLWSA-N |
| XLogP | 3.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|