C21H27NO8 — CID 24822486
methyl 2-[[(6E)-16,18-dihydroxy-4-methyl-2,12-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-10-yl]amino]oxyacetate (PubChem CID 24822486) has the molecular formula C21H27NO8 and a molecular weight of 421.45 g/mol. Its IUPAC name is methyl 2-[[(6E)-16,18-dihydroxy-4-methyl-2,12-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-10-yl]amino]oxyacetate.
| Compound Name | methyl 2-[[(6E)-16,18-dihydroxy-4-methyl-2,12-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-10-yl]amino]oxyacetate |
|---|---|
| PubChem CID | 24822486 |
| Molecular Formula | C21H27NO8 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | methyl 2-[[(6E)-16,18-dihydroxy-4-methyl-2,12-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-10-yl]amino]oxyacetate |
| SMILES | COC(=O)CONC1CC/C=C/CC(C)OC(=O)c2c(O)cc(O)cc2CC(=O)C1 |
| InChI | InChI=1S/C21H27NO8/c1-13-6-4-3-5-7-15(22-29-12-19(26)28-2)10-16(23)8-14-9-17(24)11-18(25)20(14)21(27)30-13/h3-4,9,11,13,15,22,24-25H,5-8,10,12H2,1-2H3/b4-3+ |
| InChIKey | XNTRAYJQMOMCSQ-ONEGZZNKSA-N |
| XLogP | 1.95 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|