C16H18O7 — CID 163149872
14,16-dihydroxy-4,8-dimethyl-3,7-dioxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-2,6,10-trione (PubChem CID 163149872) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 14,16-dihydroxy-4,8-dimethyl-3,7-dioxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-2,6,10-trione.
| Compound Name | 14,16-dihydroxy-4,8-dimethyl-3,7-dioxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-2,6,10-trione |
|---|---|
| PubChem CID | 163149872 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 14,16-dihydroxy-4,8-dimethyl-3,7-dioxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-2,6,10-trione |
| SMILES | CC1CC(=O)Cc2cc(O)cc(O)c2C(=O)OC(C)CC(=O)O1 |
| InChI | InChI=1S/C16H18O7/c1-8-3-11(17)5-10-6-12(18)7-13(19)15(10)16(21)23-9(2)4-14(20)22-8/h6-9,18-19H,3-5H2,1-2H3 |
| InChIKey | MXVPKZLJHGRLDD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |