C23H31NO7 — CID 24823145
methyl 2-[(E)-[(4S,6E)-16,18-dihydroxy-2-oxo-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-12-ylidene]amino]oxyacetate (PubChem CID 24823145) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is methyl 2-[(E)-[(4S,6E)-16,18-dihydroxy-2-oxo-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-12-ylidene]amino]oxyacetate.
| Compound Name | methyl 2-[(E)-[(4S,6E)-16,18-dihydroxy-2-oxo-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-12-ylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 24823145 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | methyl 2-[(E)-[(4S,6E)-16,18-dihydroxy-2-oxo-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-12-ylidene]amino]oxyacetate |
| SMILES | COC(=O)CO/N=C1\CCCC/C=C/C[C@@H](C(C)C)OC(=O)c2c(O)cc(O)cc2C1 |
| InChI | InChI=1S/C23H31NO7/c1-15(2)20-10-8-6-4-5-7-9-17(24-30-14-21(27)29-3)11-16-12-18(25)13-19(26)22(16)23(28)31-20/h6,8,12-13,15,20,25-26H,4-5,7,9-11,14H2,1-3H3/b8-6+,24-17+/t20-/m0/s1 |
| InChIKey | VBGBBQBNAICBEJ-NWNYSQAWSA-N |
| XLogP | 3.89 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|