C22H27NO7 — CID 123273652
2-[[(4S,10E,12Z)-16,18-dihydroxy-2-oxo-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxyacetic acid (PubChem CID 123273652) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is 2-[[(4S,10E,12Z)-16,18-dihydroxy-2-oxo-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxyacetic acid.
| Compound Name | 2-[[(4S,10E,12Z)-16,18-dihydroxy-2-oxo-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 123273652 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[[(4S,10E,12Z)-16,18-dihydroxy-2-oxo-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxyacetic acid |
| SMILES | CC(C)[C@@H]1CC=CCC/C=C/C(NOCC(=O)O)=C/c2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C22H27NO7/c1-14(2)19-9-7-5-3-4-6-8-16(23-29-13-20(26)27)10-15-11-17(24)12-18(25)21(15)22(28)30-19/h5-8,10-12,14,19,23-25H,3-4,9,13H2,1-2H3,(H,26,27)/b7-5?,8-6+,16-10-/t19-/m0/s1 |
| InChIKey | UWXMEMOQAGYWFA-SYZODPKJSA-N |
| XLogP | 3.52 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|