C30H34N2O6 — CID 123191354
(10E,12Z)-16,18-dihydroxy-12-[[2-oxo-2-(4-phenylpiperidin-1-yl)ethoxy]amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one (PubChem CID 123191354) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is (10E,12Z)-16,18-dihydroxy-12-[[2-oxo-2-(4-phenylpiperidin-1-yl)ethoxy]amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one.
| Compound Name | (10E,12Z)-16,18-dihydroxy-12-[[2-oxo-2-(4-phenylpiperidin-1-yl)ethoxy]amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 123191354 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | (10E,12Z)-16,18-dihydroxy-12-[[2-oxo-2-(4-phenylpiperidin-1-yl)ethoxy]amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
| SMILES | O=C1OCCC=CCC/C=C/C(NOCC(=O)N2CCC(c3ccccc3)CC2)=C/c2cc(O)cc(O)c21 |
| InChI | InChI=1S/C30H34N2O6/c33-26-19-24-18-25(12-8-3-1-2-4-9-17-37-30(36)29(24)27(34)20-26)31-38-21-28(35)32-15-13-23(14-16-32)22-10-6-5-7-11-22/h2,4-8,10-12,18-20,23,31,33-34H,1,3,9,13-17,21H2/b4-2?,12-8+,25-18- |
| InChIKey | LZKYDQUHTUGMOQ-BSQNMGSSSA-N |
| XLogP | 4.82 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|