C27H37ClN2O7 — CID 58373342
(6E,10E)-15-chloro-16-(ethoxymethoxy)-18-hydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 58373342) has the molecular formula C27H37ClN2O7 and a molecular weight of 537.05 g/mol. Its IUPAC name is (6E,10E)-15-chloro-16-(ethoxymethoxy)-18-hydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E)-15-chloro-16-(ethoxymethoxy)-18-hydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 58373342 |
| Molecular Formula | C27H37ClN2O7 |
| Molecular Weight | 537.05 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | (6E,10E)-15-chloro-16-(ethoxymethoxy)-18-hydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | CCOCOc1cc(O)c2c(c1Cl)CC(NOCC(=O)N1CCCCC1)/C=C/CC/C=C/CCOC2=O |
| InChI | InChI=1S/C27H37ClN2O7/c1-2-34-19-36-23-17-22(31)25-21(26(23)28)16-20(12-8-5-3-4-6-11-15-35-27(25)33)29-37-18-24(32)30-13-9-7-10-14-30/h4,6,8,12,17,20,29,31H,2-3,5,7,9-11,13-16,18-19H2,1H3/b6-4+,12-8+ |
| InChIKey | YZIYQHQBXXXNCN-RZYXTZOYSA-N |
| XLogP | 4.32 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.05 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|