C22H26N2O4 — CID 164556779
cyclopropylbenzene;4-[2-(4-hydroxyphenoxy)acetyl]piperazine-1-carbaldehyde (PubChem CID 164556779) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is cyclopropylbenzene;4-[2-(4-hydroxyphenoxy)acetyl]piperazine-1-carbaldehyde.
| Compound Name | cyclopropylbenzene;4-[2-(4-hydroxyphenoxy)acetyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 164556779 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | cyclopropylbenzene;4-[2-(4-hydroxyphenoxy)acetyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C(=O)COc2ccc(O)cc2)CC1.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C13H16N2O4.C9H10/c16-10-14-5-7-15(8-6-14)13(18)9-19-12-3-1-11(17)2-4-12;1-2-4-8(5-3-1)9-6-7-9/h1-4,10,17H,5-9H2;1-5,9H,6-7H2 |
| InChIKey | NBWAWHLDYDAPRY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|