About 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene
4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene (PubChem CID 164556781) has the molecular formula C22H32N2O2S
and a molecular weight of 388.58 g/mol. Its IUPAC name is 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene.
Molecular Properties
| Compound Name | 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene |
| PubChem CID | 164556781 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene |
| SMILES | O=CN1CCN(C(=O)CSC2CCCCC2)CC1.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C13H22N2O2S.C9H10/c16-11-14-6-8-15(9-7-14)13(17)10-18-12-4-2-1-3-5-12;1-2-4-8(5-3-1)9-6-7-9/h11-12H,1-10H2;1-5,9H,6-7H2 |
| InChIKey | ROQHCFRKCRRUPR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene?
The IUPAC name of 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene (CID 164556781) is 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene.
What is the SMILES notation for 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene?
The canonical SMILES for 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene is O=CN1CCN(C(=O)CSC2CCCCC2)CC1.c1ccc(C2CC2)cc1.
What is the InChIKey of 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene?
The InChIKey is ROQHCFRKCRRUPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2S.C9H10/c16-11-14-6-8-15(9-7-14)13(17)10-18-12-4-2-1-3-5-12;1-2-4-8(5-3-1)9-6-7-9/h11-12H,1-10H2;1-5,9H,6-7H2.
What are the key properties of 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene?
4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene has a molecular weight of 388.58 g/mol, XLogP of 3.92, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclohexylsulfanylacetyl)piperazine-1-carbaldehyde;cyclopropylbenzene is sourced from PubChem (CID 164556781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).