C23H27N3O4 — CID 164556681
cyclopropylbenzene;4-[2-(4-formylpiperazin-1-yl)-2-oxoethoxy]benzamide (PubChem CID 164556681) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is cyclopropylbenzene;4-[2-(4-formylpiperazin-1-yl)-2-oxoethoxy]benzamide.
| Compound Name | cyclopropylbenzene;4-[2-(4-formylpiperazin-1-yl)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 164556681 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | cyclopropylbenzene;4-[2-(4-formylpiperazin-1-yl)-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCC(=O)N2CCN(C=O)CC2)cc1.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C14H17N3O4.C9H10/c15-14(20)11-1-3-12(4-2-11)21-9-13(19)17-7-5-16(10-18)6-8-17;1-2-4-8(5-3-1)9-6-7-9/h1-4,10H,5-9H2,(H2,15,20);1-5,9H,6-7H2 |
| InChIKey | QKAOXVIXHMSBBA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|