C23H26N2O4S — CID 164556788
cyclopropylbenzene;4-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]sulfanylbenzoic acid (PubChem CID 164556788) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is cyclopropylbenzene;4-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]sulfanylbenzoic acid.
| Compound Name | cyclopropylbenzene;4-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 164556788 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | cyclopropylbenzene;4-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]sulfanylbenzoic acid |
| SMILES | O=CN1CCN(C(=O)CSc2ccc(C(=O)O)cc2)CC1.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C14H16N2O4S.C9H10/c17-10-15-5-7-16(8-6-15)13(18)9-21-12-3-1-11(2-4-12)14(19)20;1-2-4-8(5-3-1)9-6-7-9/h1-4,10H,5-9H2,(H,19,20);1-5,9H,6-7H2 |
| InChIKey | KVLLFFSHVUGGSU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|