C26H35N3O6 — CID 123744339
(10E,12Z)-4-(2-aminoethyl)-16,18-dihydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one (PubChem CID 123744339) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is (10E,12Z)-4-(2-aminoethyl)-16,18-dihydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one.
| Compound Name | (10E,12Z)-4-(2-aminoethyl)-16,18-dihydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 123744339 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (10E,12Z)-4-(2-aminoethyl)-16,18-dihydroxy-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
| SMILES | NCCC1CC=CCC/C=C/C(NOCC(=O)N2CCCCC2)=C/c2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C26H35N3O6/c27-12-11-22-10-6-3-1-2-5-9-20(28-34-18-24(32)29-13-7-4-8-14-29)15-19-16-21(30)17-23(31)25(19)26(33)35-22/h3,5-6,9,15-17,22,28,30-31H,1-2,4,7-8,10-14,18,27H2/b6-3?,9-5+,20-15- |
| InChIKey | ZNGQRKCUQRPTJU-XVIRWDONSA-N |
| XLogP | 3.14 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|