C28H37ClN2O6 — CID 123497777
(10E,12Z)-15-chloro-16,18-dihydroxy-8-methyl-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one (PubChem CID 123497777) has the molecular formula C28H37ClN2O6 and a molecular weight of 533.07 g/mol. Its IUPAC name is (10E,12Z)-15-chloro-16,18-dihydroxy-8-methyl-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one.
| Compound Name | (10E,12Z)-15-chloro-16,18-dihydroxy-8-methyl-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 123497777 |
| Molecular Formula | C28H37ClN2O6 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (10E,12Z)-15-chloro-16,18-dihydroxy-8-methyl-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
| SMILES | CCCC1CC=CC(C)C/C=C/C(NOCC(=O)N2CCCCC2)=C/c2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C28H37ClN2O6/c1-3-9-21-13-8-11-19(2)10-7-12-20(30-36-18-25(34)31-14-5-4-6-15-31)16-22-26(28(35)37-21)23(32)17-24(33)27(22)29/h7-8,11-12,16-17,19,21,30,32-33H,3-6,9-10,13-15,18H2,1-2H3/b11-8?,12-7+,20-16- |
| InChIKey | SPPWXLXMHCVGCK-NUWUZMQDSA-N |
| XLogP | 5.49 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|