C20H23ClN2O6 — CID 123570955
2-[[(12Z)-15-chloro-16,18-dihydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxy-N-methylacetamide (PubChem CID 123570955) has the molecular formula C20H23ClN2O6 and a molecular weight of 422.87 g/mol. Its IUPAC name is 2-[[(12Z)-15-chloro-16,18-dihydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxy-N-methylacetamide.
| Compound Name | 2-[[(12Z)-15-chloro-16,18-dihydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxy-N-methylacetamide |
|---|---|
| PubChem CID | 123570955 |
| Molecular Formula | C20H23ClN2O6 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[[(12Z)-15-chloro-16,18-dihydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxy-N-methylacetamide |
| SMILES | CNC(=O)CON/C1=C\c2c(Cl)c(O)cc(O)c2C(=O)OCCC=CCCC=C1 |
| InChI | InChI=1S/C20H23ClN2O6/c1-22-17(26)12-29-23-13-8-6-4-2-3-5-7-9-28-20(27)18-14(10-13)19(21)16(25)11-15(18)24/h3,5-6,8,10-11,23-25H,2,4,7,9,12H2,1H3,(H,22,26)/b5-3?,8-6?,13-10- |
| InChIKey | GLHGFYRJNURXJX-XHAFAQLVSA-N |
| XLogP | 2.81 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|