C26H33ClN2O6 — CID 123229455
(4R,10E,12Z)-15-chloro-16,18-dihydroxy-4,8-dimethyl-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one (PubChem CID 123229455) has the molecular formula C26H33ClN2O6 and a molecular weight of 505.01 g/mol. Its IUPAC name is (4R,10E,12Z)-15-chloro-16,18-dihydroxy-4,8-dimethyl-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one.
| Compound Name | (4R,10E,12Z)-15-chloro-16,18-dihydroxy-4,8-dimethyl-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 123229455 |
| Molecular Formula | C26H33ClN2O6 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (4R,10E,12Z)-15-chloro-16,18-dihydroxy-4,8-dimethyl-12-[(2-oxo-2-piperidin-1-ylethoxy)amino]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
| SMILES | CC1C=CC[C@@H](C)OC(=O)c2c(O)cc(O)c(Cl)c2/C=C(NOCC(=O)N2CCCCC2)/C=C/C1 |
| InChI | InChI=1S/C26H33ClN2O6/c1-17-8-6-10-18(2)35-26(33)24-20(25(27)22(31)15-21(24)30)14-19(11-7-9-17)28-34-16-23(32)29-12-4-3-5-13-29/h6-8,11,14-15,17-18,28,30-31H,3-5,9-10,12-13,16H2,1-2H3/b8-6?,11-7+,19-14-/t17?,18-/m1/s1 |
| InChIKey | XHCGVDSFACSUIT-NMUAUQCESA-N |
| XLogP | 4.71 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|