C25H33N3O6 — CID 123511251
(4R,8S)-8-amino-16,18-dihydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 123511251) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is (4R,8S)-8-amino-16,18-dihydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (4R,8S)-8-amino-16,18-dihydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 123511251 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | (4R,8S)-8-amino-16,18-dihydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | C[C@@H]1CC=C[C@@H](N)CC=CC(=NOCC(=O)N2CCCCC2)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C25H33N3O6/c1-17-7-5-8-19(26)9-6-10-20(27-33-16-23(31)28-11-3-2-4-12-28)13-18-14-21(29)15-22(30)24(18)25(32)34-17/h5-6,8,10,14-15,17,19,29-30H,2-4,7,9,11-13,16,26H2,1H3/t17-,19-/m1/s1 |
| InChIKey | AJQGQJUYMDMBDP-IEBWSBKVSA-N |
| XLogP | 2.80 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|