C26H35N3O6 — CID 129266807
(4R,6E,8R,10E,12E)-8-amino-16,18-dihydroxy-4,15-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one (PubChem CID 129266807) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is (4R,6E,8R,10E,12E)-8-amino-16,18-dihydroxy-4,15-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one.
| Compound Name | (4R,6E,8R,10E,12E)-8-amino-16,18-dihydroxy-4,15-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 129266807 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (4R,6E,8R,10E,12E)-8-amino-16,18-dihydroxy-4,15-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
| SMILES | Cc1c(O)cc(O)c2c1CC(=N\OCC(=O)N1CCCCC1)/C=C/C[C@@H](N)/C=C/C[C@@H](C)OC2=O |
| InChI | InChI=1S/C26H35N3O6/c1-17-8-6-9-19(27)10-7-11-20(28-34-16-24(32)29-12-4-3-5-13-29)14-21-18(2)22(30)15-23(31)25(21)26(33)35-17/h6-7,9,11,15,17,19,30-31H,3-5,8,10,12-14,16,27H2,1-2H3/b9-6+,11-7+,28-20-/t17-,19+/m1/s1 |
| InChIKey | AGRAUYRAUCFKQZ-ASXJGVGLSA-N |
| XLogP | 3.11 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|