C26H27ClN2O6 — CID 123541503
N-benzyl-2-[[(10E,12Z)-15-chloro-16,18-dihydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxyacetamide (PubChem CID 123541503) has the molecular formula C26H27ClN2O6 and a molecular weight of 498.96 g/mol. Its IUPAC name is N-benzyl-2-[[(10E,12Z)-15-chloro-16,18-dihydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxyacetamide.
| Compound Name | N-benzyl-2-[[(10E,12Z)-15-chloro-16,18-dihydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxyacetamide |
|---|---|
| PubChem CID | 123541503 |
| Molecular Formula | C26H27ClN2O6 |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N-benzyl-2-[[(10E,12Z)-15-chloro-16,18-dihydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-12-yl]amino]oxyacetamide |
| SMILES | O=C(CONC1=C\c2c(Cl)c(O)cc(O)c2C(=O)OCCC=CCC\C=C\1)NCc1ccccc1 |
| InChI | InChI=1S/C26H27ClN2O6/c27-25-20-14-19(29-35-17-23(32)28-16-18-10-6-5-7-11-18)12-8-3-1-2-4-9-13-34-26(33)24(20)21(30)15-22(25)31/h2,4-8,10-12,14-15,29-31H,1,3,9,13,16-17H2,(H,28,32)/b4-2?,12-8+,19-14- |
| InChIKey | OFOWWMHWBKCADE-RLSAEOSBSA-N |
| XLogP | 4.38 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|