C21H26N2O6 — CID 143835784
N-(2-hydroxyethyl)-2-[(Z)-[(6E,10E)-16-hydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxyacetamide (PubChem CID 143835784) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[(Z)-[(6E,10E)-16-hydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxyacetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[(Z)-[(6E,10E)-16-hydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 143835784 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[(Z)-[(6E,10E)-16-hydroxy-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxyacetamide |
| SMILES | O=C(CO/N=C1\C=C\CC/C=C/CCOC(=O)c2ccc(O)cc2C1)NCCO |
| InChI | InChI=1S/C21H26N2O6/c24-11-10-22-20(26)15-29-23-17-7-5-3-1-2-4-6-12-28-21(27)19-9-8-18(25)14-16(19)13-17/h2,4-5,7-9,14,24-25H,1,3,6,10-13,15H2,(H,22,26)/b4-2+,7-5+,23-17+ |
| InChIKey | JUCWGBALEMOWPM-SEKHEANFSA-N |
| XLogP | 1.87 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|