C30H41ClN2O4 — CID 58373236
(6E,10E,12Z)-15-chloro-8,16,18-trimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 58373236) has the molecular formula C30H41ClN2O4 and a molecular weight of 529.12 g/mol. Its IUPAC name is (6E,10E,12Z)-15-chloro-8,16,18-trimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12Z)-15-chloro-8,16,18-trimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 58373236 |
| Molecular Formula | C30H41ClN2O4 |
| Molecular Weight | 529.12 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | (6E,10E,12Z)-15-chloro-8,16,18-trimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | CCCC1C/C=C/C(C)C/C=C/C(=N\OCC(=O)N2CCCCC2)Cc2c(Cl)c(C)cc(C)c2C(=O)O1 |
| InChI | InChI=1S/C30H41ClN2O4/c1-5-11-25-15-10-13-21(2)12-9-14-24(32-36-20-27(34)33-16-7-6-8-17-33)19-26-28(30(35)37-25)22(3)18-23(4)29(26)31/h9-10,13-14,18,21,25H,5-8,11-12,15-17,19-20H2,1-4H3/b13-10+,14-9+,32-24+ |
| InChIKey | XIWPXKAMPJCXBE-XKJPKGTESA-N |
| XLogP | 6.75 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.12 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|