C29H41ClN2O4 — CID 58373375
(6E,12E)-15-chloro-16,18-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one (PubChem CID 58373375) has the molecular formula C29H41ClN2O4 and a molecular weight of 517.11 g/mol. Its IUPAC name is (6E,12E)-15-chloro-16,18-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one.
| Compound Name | (6E,12E)-15-chloro-16,18-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one |
|---|---|
| PubChem CID | 58373375 |
| Molecular Formula | C29H41ClN2O4 |
| Molecular Weight | 517.11 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | (6E,12E)-15-chloro-16,18-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one |
| SMILES | CCCC1C/C=C/CCCC/C(=N\OCC(=O)N2CCCCC2)Cc2c(Cl)c(C)cc(C)c2C(=O)O1 |
| InChI | InChI=1S/C29H41ClN2O4/c1-4-13-24-15-10-7-5-6-9-14-23(31-35-20-26(33)32-16-11-8-12-17-32)19-25-27(29(34)36-24)21(2)18-22(3)28(25)30/h7,10,18,24H,4-6,8-9,11-17,19-20H2,1-3H3/b10-7+,31-23+ |
| InChIKey | VFZCUUXPROCLNT-IWHGMBCMSA-N |
| XLogP | 6.73 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.11 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|