C31H35ClN2O6 — CID 58421974
(6E,10E,12E)-12-[2-(4-benzylpiperidin-1-yl)-2-oxoethoxy]imino-15-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 58421974) has the molecular formula C31H35ClN2O6 and a molecular weight of 567.08 g/mol. Its IUPAC name is (6E,10E,12E)-12-[2-(4-benzylpiperidin-1-yl)-2-oxoethoxy]imino-15-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12E)-12-[2-(4-benzylpiperidin-1-yl)-2-oxoethoxy]imino-15-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 58421974 |
| Molecular Formula | C31H35ClN2O6 |
| Molecular Weight | 567.08 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | (6E,10E,12E)-12-[2-(4-benzylpiperidin-1-yl)-2-oxoethoxy]imino-15-chloro-16,18-dihydroxy-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | O=C1OCC/C=C/CC/C=C/C(=N/OCC(=O)N2CCC(Cc3ccccc3)CC2)Cc2c(Cl)c(O)cc(O)c21 |
| InChI | InChI=1S/C31H35ClN2O6/c32-30-25-19-24(12-8-3-1-2-4-9-17-39-31(38)29(25)26(35)20-27(30)36)33-40-21-28(37)34-15-13-23(14-16-34)18-22-10-6-5-7-11-22/h2,4-8,10-12,20,23,35-36H,1,3,9,13-19,21H2/b4-2+,12-8+,33-24- |
| InChIKey | WFNHFHSQZWVUQA-OWLZZAHXSA-N |
| XLogP | 5.60 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.08 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|