C26H36N2O6 — CID 159728435
2-[[(6E,10E)-16,18-dihydroxy-2-oxo-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxy-N,N-diethylacetamide (PubChem CID 159728435) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is 2-[[(6E,10E)-16,18-dihydroxy-2-oxo-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxy-N,N-diethylacetamide.
| Compound Name | 2-[[(6E,10E)-16,18-dihydroxy-2-oxo-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxy-N,N-diethylacetamide |
|---|---|
| PubChem CID | 159728435 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-[[(6E,10E)-16,18-dihydroxy-2-oxo-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxy-N,N-diethylacetamide |
| SMILES | CCCC1C/C=C/CC/C=C/C(=NOCC(=O)N(CC)CC)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C26H36N2O6/c1-4-12-22-14-11-9-7-8-10-13-20(27-33-18-24(31)28(5-2)6-3)15-19-16-21(29)17-23(30)25(19)26(32)34-22/h9-11,13,16-17,22,29-30H,4-8,12,14-15,18H2,1-3H3/b11-9+,13-10+,27-20? |
| InChIKey | NAXRMVOJTGVHQW-YCAAIJEPSA-N |
| XLogP | 4.50 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|