C33H49NO6 — CID 172918527
(6E,10E,12Z)-16-ethoxy-18-methoxy-12-(2-oxodecoxyimino)-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 172918527) has the molecular formula C33H49NO6 and a molecular weight of 555.76 g/mol. Its IUPAC name is (6E,10E,12Z)-16-ethoxy-18-methoxy-12-(2-oxodecoxyimino)-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12Z)-16-ethoxy-18-methoxy-12-(2-oxodecoxyimino)-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 172918527 |
| Molecular Formula | C33H49NO6 |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.36 |
| IUPAC Name | (6E,10E,12Z)-16-ethoxy-18-methoxy-12-(2-oxodecoxyimino)-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | CCCCCCCCC(=O)CO/N=C1\C=C\CC/C=C/CC(CCC)OC(=O)c2c(cc(OCC)cc2OC)C1 |
| InChI | InChI=1S/C33H49NO6/c1-5-8-9-10-13-16-20-28(35)25-39-34-27-19-15-12-11-14-17-21-29(18-6-2)40-33(36)32-26(22-27)23-30(38-7-3)24-31(32)37-4/h14-15,17,19,23-24,29H,5-13,16,18,20-22,25H2,1-4H3/b17-14+,19-15+,34-27+ |
| InChIKey | BXMDFCOEVQQEDQ-OWCGZGTGSA-N |
| XLogP | 7.95 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|