C31H44N2O9 — CID 123889186
(4R,8R)-16,18-bis(ethoxymethoxy)-8-hydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 123889186) has the molecular formula C31H44N2O9 and a molecular weight of 588.70 g/mol. Its IUPAC name is (4R,8R)-16,18-bis(ethoxymethoxy)-8-hydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (4R,8R)-16,18-bis(ethoxymethoxy)-8-hydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 123889186 |
| Molecular Formula | C31H44N2O9 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | (4R,8R)-16,18-bis(ethoxymethoxy)-8-hydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | CCOCOc1cc2c(c(OCOCC)c1)C(=O)O[C@H](C)CC=C[C@H](O)CC=CC(=NOCC(=O)N1CCCCC1)C2 |
| InChI | InChI=1S/C31H44N2O9/c1-4-37-21-39-27-18-24-17-25(32-41-20-29(35)33-15-7-6-8-16-33)12-10-14-26(34)13-9-11-23(3)42-31(36)30(24)28(19-27)40-22-38-5-2/h9-10,12-13,18-19,23,26,34H,4-8,11,14-17,20-22H2,1-3H3/t23-,26+/m1/s1 |
| InChIKey | VNLKSNGZYHRHAH-BVAGGSTKSA-N |
| XLogP | 4.17 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|