C34H51N3O9 — CID 123776518
(4R)-8-(3-aminopropoxy)-16,18-bis(ethoxymethoxy)-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 123776518) has the molecular formula C34H51N3O9 and a molecular weight of 645.79 g/mol. Its IUPAC name is (4R)-8-(3-aminopropoxy)-16,18-bis(ethoxymethoxy)-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (4R)-8-(3-aminopropoxy)-16,18-bis(ethoxymethoxy)-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 123776518 |
| Molecular Formula | C34H51N3O9 |
| Molecular Weight | 645.79 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | (4R)-8-(3-aminopropoxy)-16,18-bis(ethoxymethoxy)-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | CCOCOc1cc2c(c(OCOCC)c1)C(=O)O[C@H](C)CC=CC(OCCCN)CC=CC(=NOCC(=O)N1CCCCC1)C2 |
| InChI | InChI=1S/C34H51N3O9/c1-4-40-24-43-30-21-27-20-28(36-45-23-32(38)37-17-7-6-8-18-37)13-10-15-29(42-19-11-16-35)14-9-12-26(3)46-34(39)33(27)31(22-30)44-25-41-5-2/h9-10,13-14,21-22,26,29H,4-8,11-12,15-20,23-25,35H2,1-3H3/t26-,29?/m1/s1 |
| InChIKey | AXMVCHUSSDDRIP-QZWVJJBASA-N |
| XLogP | 4.55 |
| TPSA | 140.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|