C27H37N3O6 — CID 143835918
(6E,10E,12E)-8-(3-aminopropoxy)-16-hydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 143835918) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is (6E,10E,12E)-8-(3-aminopropoxy)-16-hydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12E)-8-(3-aminopropoxy)-16-hydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 143835918 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | (6E,10E,12E)-8-(3-aminopropoxy)-16-hydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | NCCCOC1/C=C/CCOC(=O)c2ccc(O)cc2CC(=N\OCC(=O)N2CCCCC2)/C=C/C1 |
| InChI | InChI=1S/C27H37N3O6/c28-13-7-17-34-24-9-2-5-16-35-27(33)25-12-11-23(31)19-21(25)18-22(8-6-10-24)29-36-20-26(32)30-14-3-1-4-15-30/h2,6,8-9,11-12,19,24,31H,1,3-5,7,10,13-18,20,28H2/b8-6+,9-2+,29-22- |
| InChIKey | SWNRHQDNJCHJFH-CJBXIAKUSA-N |
| XLogP | 3.12 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|