C26H34N2O5 — CID 121367059
2-[(Z)-[(6E,10E)-8,16-dihydroxy-18-methyl-2-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxy-1-piperidin-1-ylethanone (PubChem CID 121367059) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[(Z)-[(6E,10E)-8,16-dihydroxy-18-methyl-2-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxy-1-piperidin-1-ylethanone.
| Compound Name | 2-[(Z)-[(6E,10E)-8,16-dihydroxy-18-methyl-2-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxy-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 121367059 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[(Z)-[(6E,10E)-8,16-dihydroxy-18-methyl-2-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxy-1-piperidin-1-ylethanone |
| SMILES | C=C1OCC/C=C/C(O)C/C=C/C(=N\OCC(=O)N2CCCCC2)Cc2cc(O)cc(C)c21 |
| InChI | InChI=1S/C26H34N2O5/c1-19-15-24(30)17-21-16-22(27-33-18-25(31)28-12-5-3-6-13-28)9-8-11-23(29)10-4-7-14-32-20(2)26(19)21/h4,8-10,15,17,23,29-30H,2-3,5-7,11-14,16,18H2,1H3/b9-8+,10-4+,27-22+ |
| InChIKey | AVDJALGELSDBDZ-SZKLRKEUSA-N |
| XLogP | 3.88 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|