C24H29ClN2O6 — CID 143835759
(6E,10E,12Z)-15-chloro-8,16-dihydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 143835759) has the molecular formula C24H29ClN2O6 and a molecular weight of 476.96 g/mol. Its IUPAC name is (6E,10E,12Z)-15-chloro-8,16-dihydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12Z)-15-chloro-8,16-dihydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 143835759 |
| Molecular Formula | C24H29ClN2O6 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (6E,10E,12Z)-15-chloro-8,16-dihydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | O=C1OCC/C=C/C(O)C/C=C/C(=N\OCC(=O)N2CCCCC2)Cc2c1ccc(O)c2Cl |
| InChI | InChI=1S/C24H29ClN2O6/c25-23-20-15-17(26-33-16-22(30)27-12-3-1-4-13-27)7-6-9-18(28)8-2-5-14-32-24(31)19(20)10-11-21(23)29/h2,6-8,10-11,18,28-29H,1,3-5,9,12-16H2/b7-6+,8-2+,26-17+ |
| InChIKey | CILZEACYMAMMCU-IHVKZCFLSA-N |
| XLogP | 3.40 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|