C30H41N3O6 — CID 143835925
(6E,10E,12Z)-8-(3-aminopropoxy)-18-cyclopropyl-16-hydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 143835925) has the molecular formula C30H41N3O6 and a molecular weight of 539.67 g/mol. Its IUPAC name is (6E,10E,12Z)-8-(3-aminopropoxy)-18-cyclopropyl-16-hydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12Z)-8-(3-aminopropoxy)-18-cyclopropyl-16-hydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 143835925 |
| Molecular Formula | C30H41N3O6 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | (6E,10E,12Z)-8-(3-aminopropoxy)-18-cyclopropyl-16-hydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | NCCCOC1/C=C/CCOC(=O)c2c(cc(O)cc2C2CC2)CC(=N/OCC(=O)N2CCCCC2)/C=C/C1 |
| InChI | InChI=1S/C30H41N3O6/c31-13-7-17-37-26-9-2-5-16-38-30(36)29-23(19-25(34)20-27(29)22-11-12-22)18-24(8-6-10-26)32-39-21-28(35)33-14-3-1-4-15-33/h2,6,8-9,19-20,22,26,34H,1,3-5,7,10-18,21,31H2/b8-6+,9-2+,32-24+ |
| InChIKey | IVSBSVOODSWFLG-GEGLNRNKSA-N |
| XLogP | 3.99 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|