C30H29NO5 — CID 158285184
(4R,6E,10E)-16,18-dihydroxy-4-phenyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 158285184) has the molecular formula C30H29NO5 and a molecular weight of 483.56 g/mol. Its IUPAC name is (4R,6E,10E)-16,18-dihydroxy-4-phenyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (4R,6E,10E)-16,18-dihydroxy-4-phenyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 158285184 |
| Molecular Formula | C30H29NO5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (4R,6E,10E)-16,18-dihydroxy-4-phenyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | O=C1O[C@@H](c2ccccc2)C/C=C/CC/C=C/C(=NOCc2ccccc2)Cc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C30H29NO5/c32-26-19-24-18-25(31-35-21-22-12-6-4-7-13-22)16-10-2-1-3-11-17-28(23-14-8-5-9-15-23)36-30(34)29(24)27(33)20-26/h3-16,19-20,28,32-33H,1-2,17-18,21H2/b11-3+,16-10+,31-25?/t28-/m1/s1 |
| InChIKey | GKRQNFFHNGPQKG-SZPJIGBGSA-N |
| XLogP | 6.41 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|