C19H21IO5 — CID 163864150
(4S,6E,10E)-16,18-dihydroxy-4-(2-iodoethyl)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione (PubChem CID 163864150) has the molecular formula C19H21IO5 and a molecular weight of 456.28 g/mol. Its IUPAC name is (4S,6E,10E)-16,18-dihydroxy-4-(2-iodoethyl)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione.
| Compound Name | (4S,6E,10E)-16,18-dihydroxy-4-(2-iodoethyl)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
|---|---|
| PubChem CID | 163864150 |
| Molecular Formula | C19H21IO5 |
| Molecular Weight | 456.28 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | (4S,6E,10E)-16,18-dihydroxy-4-(2-iodoethyl)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
| SMILES | O=C1/C=C/CC/C=C/C[C@@H](CCI)OC(=O)c2c(O)cc(O)cc2C1 |
| InChI | InChI=1S/C19H21IO5/c20-9-8-16-7-5-3-1-2-4-6-14(21)10-13-11-15(22)12-17(23)18(13)19(24)25-16/h3-6,11-12,16,22-23H,1-2,7-10H2/b5-3+,6-4+/t16-/m0/s1 |
| InChIKey | PFDUUZJBHMEQBC-ZBBXFQFBSA-N |
| XLogP | 3.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|